C30H54N2O8S2 — CID 177012731
2-[2-[(3-but-3-ynoxy-3-oxopropyl)-[3-[(2-ethoxy-2-oxoethyl)amino]propyl]carbamoyl]oxyethyldisulfanyl]ethyl nonanoate;ethane (PubChem CID 177012731) has the molecular formula C30H54N2O8S2 and a molecular weight of 634.90 g/mol. Its IUPAC name is 2-[2-[(3-but-3-ynoxy-3-oxopropyl)-[3-[(2-ethoxy-2-oxoethyl)amino]propyl]carbamoyl]oxyethyldisulfanyl]ethyl nonanoate;ethane.
| Compound Name | 2-[2-[(3-but-3-ynoxy-3-oxopropyl)-[3-[(2-ethoxy-2-oxoethyl)amino]propyl]carbamoyl]oxyethyldisulfanyl]ethyl nonanoate;ethane |
|---|---|
| PubChem CID | 177012731 |
| Molecular Formula | C30H54N2O8S2 |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | 2-[2-[(3-but-3-ynoxy-3-oxopropyl)-[3-[(2-ethoxy-2-oxoethyl)amino]propyl]carbamoyl]oxyethyldisulfanyl]ethyl nonanoate;ethane |
| SMILES | C#CCCOC(=O)CCN(CCCNCC(=O)OCC)C(=O)OCCSSCCOC(=O)CCCCCCCC.CC |
| InChI | InChI=1S/C28H48N2O8S2.C2H6/c1-4-7-9-10-11-12-14-25(31)37-20-22-39-40-23-21-38-28(34)30(18-15-26(32)36-19-8-5-2)17-13-16-29-24-27(33)35-6-3;1-2/h2,29H,4,6-24H2,1,3H3;1-2H3 |
| InChIKey | VIPBSDBYDQBKRX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|