C26H37F3N4O4 — CID 177015647
2-(1-adamantyl)-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-3-methylbutanamide (PubChem CID 177015647) has the molecular formula C26H37F3N4O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-3-methylbutanamide.
| Compound Name | 2-(1-adamantyl)-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 177015647 |
| Molecular Formula | C26H37F3N4O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 2-(1-adamantyl)-N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H37F3N4O4/c1-13(2)21(25-6-14-3-15(7-25)5-16(4-14)8-25)24(36)31-9-18-23(35)22(34)17(12-37-18)32-20-11-30-10-19(33-20)26(27,28)29/h10-11,13-18,21-23,34-35H,3-9,12H2,1-2H3,(H,31,36)(H,32,33)/t14?,15?,16?,17-,18+,21?,22+,23-,25?/m0/s1 |
| InChIKey | SYDKGZCTIFWTFI-ZZLNFAHLSA-N |
| XLogP | 3.00 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |