C16H19N3O2Sn — CID 177017422
1-(6-trimethylstannylquinolin-3-yl)-1,3-diazinane-2,4-dione (PubChem CID 177017422) has the molecular formula C16H19N3O2Sn and a molecular weight of 404.06 g/mol. Its IUPAC name is 1-(6-trimethylstannylquinolin-3-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(6-trimethylstannylquinolin-3-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177017422 |
| Molecular Formula | C16H19N3O2Sn |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 1-(6-trimethylstannylquinolin-3-yl)-1,3-diazinane-2,4-dione |
| SMILES | C[Sn](C)(C)c1ccc2ncc(N3CCC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C13H10N3O2.3CH3.Sn/c17-12-5-6-16(13(18)15-12)10-7-9-3-1-2-4-11(9)14-8-10;;;;/h2-4,7-8H,5-6H2,(H,15,17,18);3*1H3; |
| InChIKey | GOCZNFWCNPOELU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |