C8H15N — CID 177020331
(1R,6S)-N,6-dimethylcyclohex-3-en-1-amine (PubChem CID 177020331) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (1R,6S)-N,6-dimethylcyclohex-3-en-1-amine.
| Compound Name | (1R,6S)-N,6-dimethylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 177020331 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (1R,6S)-N,6-dimethylcyclohex-3-en-1-amine |
| SMILES | CN[C@@H]1CC=CC[C@@H]1C |
| InChI | InChI=1S/C8H15N/c1-7-5-3-4-6-8(7)9-2/h3-4,7-9H,5-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | PQWUDSVUYFFQQT-JGVFFNPUSA-N |
| XLogP | 1.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|