C22H23NO5 — CID 177027434
2-ethylisoindole-1,3-dione;4-methyl-2,3-dihydroinden-1-one;methyl formate (PubChem CID 177027434) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-ethylisoindole-1,3-dione;4-methyl-2,3-dihydroinden-1-one;methyl formate.
| Compound Name | 2-ethylisoindole-1,3-dione;4-methyl-2,3-dihydroinden-1-one;methyl formate |
|---|---|
| PubChem CID | 177027434 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-ethylisoindole-1,3-dione;4-methyl-2,3-dihydroinden-1-one;methyl formate |
| SMILES | CCN1C(=O)c2ccccc2C1=O.COC=O.Cc1cccc2c1CCC2=O |
| InChI | InChI=1S/C10H9NO2.C10H10O.C2H4O2/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13;1-7-3-2-4-9-8(7)5-6-10(9)11;1-4-2-3/h3-6H,2H2,1H3;2-4H,5-6H2,1H3;2H,1H3 |
| InChIKey | RRWWOGZZPWEREA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|