C16H24N4 — CID 177033608
1-(3-ethynyl-5-propan-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)-N,N-dimethylethenamine (PubChem CID 177033608) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 1-(3-ethynyl-5-propan-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)-N,N-dimethylethenamine.
| Compound Name | 1-(3-ethynyl-5-propan-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 177033608 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 1-(3-ethynyl-5-propan-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)-N,N-dimethylethenamine |
| SMILES | C#Cc1c(C(=C)N(C)C)nn2c1CN(C(C)C)CCC2 |
| InChI | InChI=1S/C16H24N4/c1-7-14-15-11-19(12(2)3)9-8-10-20(15)17-16(14)13(4)18(5)6/h1,12H,4,8-11H2,2-3,5-6H3 |
| InChIKey | YEHTTWYQRUVVCT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|