C13H16O5 — CID 177069934
(3-ethyloxetan-3-yl)methyl 3,4-dihydroxybenzoate (PubChem CID 177069934) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (3-ethyloxetan-3-yl)methyl 3,4-dihydroxybenzoate.
| Compound Name | (3-ethyloxetan-3-yl)methyl 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 177069934 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (3-ethyloxetan-3-yl)methyl 3,4-dihydroxybenzoate |
| SMILES | CCC1(COC(=O)c2ccc(O)c(O)c2)COC1 |
| InChI | InChI=1S/C13H16O5/c1-2-13(6-17-7-13)8-18-12(16)9-3-4-10(14)11(15)5-9/h3-5,14-15H,2,6-8H2,1H3 |
| InChIKey | MEESCCNOTCYACT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|