C32H42N6O6 — CID 177078848
ethyl 2-[4-amino-2-(methoxymethoxy)-5-(methyliminomethyl)phenyl]-6-[(3R,5S)-3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]quinazoline-4-carboxylate (PubChem CID 177078848) has the molecular formula C32H42N6O6 and a molecular weight of 606.72 g/mol. Its IUPAC name is ethyl 2-[4-amino-2-(methoxymethoxy)-5-(methyliminomethyl)phenyl]-6-[(3R,5S)-3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]quinazoline-4-carboxylate.
| Compound Name | ethyl 2-[4-amino-2-(methoxymethoxy)-5-(methyliminomethyl)phenyl]-6-[(3R,5S)-3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]quinazoline-4-carboxylate |
|---|---|
| PubChem CID | 177078848 |
| Molecular Formula | C32H42N6O6 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | ethyl 2-[4-amino-2-(methoxymethoxy)-5-(methyliminomethyl)phenyl]-6-[(3R,5S)-3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]quinazoline-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(/C=N/C)c(N)cc2OCOC)nc2ccc(N3C[C@@H](C)N(C(=O)OC(C)(C)C)[C@@H](C)C3)cc12 |
| InChI | InChI=1S/C32H42N6O6/c1-9-42-30(39)28-23-13-22(37-16-19(2)38(20(3)17-37)31(40)44-32(4,5)6)10-11-26(23)35-29(36-28)24-12-21(15-34-7)25(33)14-27(24)43-18-41-8/h10-15,19-20H,9,16-18,33H2,1-8H3/b34-15+/t19-,20+ |
| InChIKey | IRKCYKCHLLKZRX-YEUZYBQSSA-N |
| XLogP | 4.92 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|