C58H45N3Si — CID 177088089
[4-[4-[9,9-dimethyl-1-(9,9'-spirobi[fluorene]-2-yl)fluoren-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane (PubChem CID 177088089) has the molecular formula C58H45N3Si and a molecular weight of 812.10 g/mol. Its IUPAC name is [4-[4-[9,9-dimethyl-1-(9,9'-spirobi[fluorene]-2-yl)fluoren-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[9,9-dimethyl-1-(9,9'-spirobi[fluorene]-2-yl)fluoren-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177088089 |
| Molecular Formula | C58H45N3Si |
| Molecular Weight | 812.10 g/mol |
| Exact Mass | 811.34 |
| IUPAC Name | [4-[4-[9,9-dimethyl-1-(9,9'-spirobi[fluorene]-2-yl)fluoren-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
| SMILES | CC1(C)c2ccccc2-c2c(-c3nc(-c4ccccc4)nc(-c4ccc([Si](C)(C)C)cc4)n3)ccc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3ccccc3-4)c21 |
| InChI | InChI=1S/C58H45N3Si/c1-57(2)47-23-13-12-22-45(47)52-46(56-60-54(36-17-7-6-8-18-36)59-55(61-56)37-27-30-39(31-28-37)62(3,4)5)34-33-40(53(52)57)38-29-32-44-43-21-11-16-26-50(43)58(51(44)35-38)48-24-14-9-19-41(48)42-20-10-15-25-49(42)58/h6-35H,1-5H3 |
| InChIKey | GEGFIFKUIJYFFT-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.10 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|