C7H8NO2Y- — CID 177102628
2,4-dimethoxy-3H-pyridin-3-ide;yttrium (PubChem CID 177102628) has the molecular formula C7H8NO2Y- and a molecular weight of 227.05 g/mol. Its IUPAC name is 2,4-dimethoxy-3H-pyridin-3-ide;yttrium.
| Compound Name | 2,4-dimethoxy-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 177102628 |
| Molecular Formula | C7H8NO2Y- |
| Molecular Weight | 227.05 g/mol |
| Exact Mass | 226.96 |
| IUPAC Name | 2,4-dimethoxy-3H-pyridin-3-ide;yttrium |
| SMILES | COc1[c-]c(OC)ncc1.[Y] |
| InChI | InChI=1S/C7H8NO2.Y/c1-9-6-3-4-8-7(5-6)10-2;/h3-4H,1-2H3;/q-1; |
| InChIKey | GKSYPXOHWKJRIG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.05 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|