C13H11IMgN2O — CID 54683866
magnesium;7-methoxy-1-methyl-8,9-dihydropyrido[3,4-b]indol-8-ide;iodide (PubChem CID 54683866) has the molecular formula C13H11IMgN2O and a molecular weight of 362.45 g/mol. Its IUPAC name is magnesium;7-methoxy-1-methyl-8,9-dihydropyrido[3,4-b]indol-8-ide;iodide.
| Compound Name | magnesium;7-methoxy-1-methyl-8,9-dihydropyrido[3,4-b]indol-8-ide;iodide |
|---|---|
| PubChem CID | 54683866 |
| Molecular Formula | C13H11IMgN2O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | magnesium;7-methoxy-1-methyl-8,9-dihydropyrido[3,4-b]indol-8-ide;iodide |
| SMILES | COc1[c-]c2[nH]c3c(C)nccc3c2cc1.[I-].[Mg+2] |
| InChI | InChI=1S/C13H11N2O.HI.Mg/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;;/h3-6,15H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | LUGYJNUBMLAISA-UHFFFAOYSA-M |
| XLogP | -0.54 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|