C30H22N3OPt- — CID 177110757
2-[4-[3-(6-ethylquinolin-8-yl)benzene-2-id-1-yl]-1H-benzimidazol-2-yl]phenol;platinum (PubChem CID 177110757) has the molecular formula C30H22N3OPt- and a molecular weight of 635.60 g/mol. Its IUPAC name is 2-[4-[3-(6-ethylquinolin-8-yl)benzene-2-id-1-yl]-1H-benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-(6-ethylquinolin-8-yl)benzene-2-id-1-yl]-1H-benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110757 |
| Molecular Formula | C30H22N3OPt- |
| Molecular Weight | 635.60 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | 2-[4-[3-(6-ethylquinolin-8-yl)benzene-2-id-1-yl]-1H-benzimidazol-2-yl]phenol;platinum |
| SMILES | CCc1cc(-c2[c-]c(-c3cccc4[nH]c(-c5ccccc5O)nc34)ccc2)c2ncccc2c1.[Pt] |
| InChI | InChI=1S/C30H22N3O.Pt/c1-2-19-16-22-10-7-15-31-28(22)25(17-19)21-9-5-8-20(18-21)23-12-6-13-26-29(23)33-30(32-26)24-11-3-4-14-27(24)34;/h3-17,34H,2H2,1H3,(H,32,33);/q-1; |
| InChIKey | QYFCKIJJTNJKAC-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.60 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|