About (C,N-diethylcarbonimidoyl)-ethylazanide;scandium
(C,N-diethylcarbonimidoyl)-ethylazanide;scandium (PubChem CID 177116218) has the molecular formula C7H15N2Sc-
and a molecular weight of 172.17 g/mol. Its IUPAC name is (C,N-diethylcarbonimidoyl)-ethylazanide;scandium.
Molecular Properties
| Compound Name | (C,N-diethylcarbonimidoyl)-ethylazanide;scandium |
| PubChem CID | 177116218 |
| Molecular Formula | C7H15N2Sc- |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | (C,N-diethylcarbonimidoyl)-ethylazanide;scandium |
| SMILES | CC/N=C(\CC)[N-]CC.[Sc] |
| InChI | InChI=1S/C7H15N2.Sc/c1-4-7(8-5-2)9-6-3;/h4-6H2,1-3H3;/q-1; |
| InChIKey | RVIVOKNHRMWQFJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (C,N-diethylcarbonimidoyl)-ethylazanide;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (C,N-diethylcarbonimidoyl)-ethylazanide;scandium?
The IUPAC name of (C,N-diethylcarbonimidoyl)-ethylazanide;scandium (CID 177116218) is (C,N-diethylcarbonimidoyl)-ethylazanide;scandium.
What is the SMILES notation for (C,N-diethylcarbonimidoyl)-ethylazanide;scandium?
The canonical SMILES for (C,N-diethylcarbonimidoyl)-ethylazanide;scandium is CC/N=C(\CC)[N-]CC.[Sc].
What is the InChIKey of (C,N-diethylcarbonimidoyl)-ethylazanide;scandium?
The InChIKey is RVIVOKNHRMWQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N2.Sc/c1-4-7(8-5-2)9-6-3;/h4-6H2,1-3H3;/q-1;.
What are the key properties of (C,N-diethylcarbonimidoyl)-ethylazanide;scandium?
(C,N-diethylcarbonimidoyl)-ethylazanide;scandium has a molecular weight of 172.17 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (C,N-diethylcarbonimidoyl)-ethylazanide;scandium is sourced from PubChem (CID 177116218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).