C44H30O — CID 177126753
1,2,3,4,5,6,8-heptadeuterio-7-(1',3',4',5',6',7',8'-heptadeuteriospiro[benzo[c]fluorene-7,9'-fluorene]-2'-yl)-9,9-bis(trideuteriomethyl)xanthene (PubChem CID 177126753) has the molecular formula C44H30O and a molecular weight of 594.85 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-7-(1',3',4',5',6',7',8'-heptadeuteriospiro[benzo[c]fluorene-7,9'-fluorene]-2'-yl)-9,9-bis(trideuteriomethyl)xanthene.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-7-(1',3',4',5',6',7',8'-heptadeuteriospiro[benzo[c]fluorene-7,9'-fluorene]-2'-yl)-9,9-bis(trideuteriomethyl)xanthene |
|---|---|
| PubChem CID | 177126753 |
| Molecular Formula | C44H30O |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-7-(1',3',4',5',6',7',8'-heptadeuteriospiro[benzo[c]fluorene-7,9'-fluorene]-2'-yl)-9,9-bis(trideuteriomethyl)xanthene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Oc1c([2H])c([2H])c(-c3c([2H])c([2H])c4c(c3[2H])C3(c5ccccc5-c5c3ccc3ccccc53)c3c([2H])c([2H])c([2H])c([2H])c3-4)c([2H])c1C2(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C44H30O/c1-43(2)36-17-9-10-18-40(36)45-41-24-21-29(26-39(41)43)28-19-22-32-31-13-5-7-15-34(31)44(38(32)25-28)35-16-8-6-14-33(35)42-30-12-4-3-11-27(30)20-23-37(42)44/h3-26H,1-2H3/i1D3,2D3,5D,7D,9D,10D,13D,15D,17D,18D,19D,21D,22D,24D,25D,26D |
| InChIKey | KRAAUVKXQNUNIE-FNDKRGBPSA-N |
| XLogP | 11.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |