C25H23N5O — CID 177154551
(1R,11R)-5-[(Z)-1-amino-3-propan-2-yliminoprop-1-en-2-yl]-18-ethynyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one (PubChem CID 177154551) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is (1R,11R)-5-[(Z)-1-amino-3-propan-2-yliminoprop-1-en-2-yl]-18-ethynyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one.
| Compound Name | (1R,11R)-5-[(Z)-1-amino-3-propan-2-yliminoprop-1-en-2-yl]-18-ethynyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 177154551 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (1R,11R)-5-[(Z)-1-amino-3-propan-2-yliminoprop-1-en-2-yl]-18-ethynyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
| SMILES | C#Cc1cccc2c1[C@H]1C[C@@H](NC2=O)c2nc3ccc(C(=C/N)/C=N/C(C)C)cc3n21 |
| InChI | InChI=1S/C25H23N5O/c1-4-15-6-5-7-18-23(15)22-11-20(29-25(18)31)24-28-19-9-8-16(10-21(19)30(22)24)17(12-26)13-27-14(2)3/h1,5-10,12-14,20,22H,11,26H2,2-3H3,(H,29,31)/b17-12+,27-13+/t20-,22-/m1/s1 |
| InChIKey | CPIKGZVQWURQOP-ALSAVDLESA-N |
| XLogP | 3.57 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|