C30H26Cl2F2N4O5 — CID 177163390
5-[4-[4-(2,3-dichlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-3,3-difluoropiperidine-1-carbonyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 177163390) has the molecular formula C30H26Cl2F2N4O5 and a molecular weight of 631.46 g/mol. Its IUPAC name is 5-[4-[4-(2,3-dichlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-3,3-difluoropiperidine-1-carbonyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[4-[4-(2,3-dichlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-3,3-difluoropiperidine-1-carbonyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177163390 |
| Molecular Formula | C30H26Cl2F2N4O5 |
| Molecular Weight | 631.46 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | 5-[4-[4-(2,3-dichlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-3,3-difluoropiperidine-1-carbonyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(C(=O)N4CCC(N5CC=C(c6cccc(Cl)c6Cl)CC5)C(F)(F)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H26Cl2F2N4O5/c31-21-3-1-2-18(25(21)32)16-8-11-36(12-9-16)23-10-13-37(15-30(23,33)34)27(41)17-4-5-19-20(14-17)29(43)38(28(19)42)22-6-7-24(39)35-26(22)40/h1-5,8,14,22-23H,6-7,9-13,15H2,(H,35,39,40) |
| InChIKey | LKWATTFJHQDAOC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|