C32H33N4O4S2+ — CID 177163770
(2,5-dioxopyrrolidin-1-yl) 6-[6-methyl-4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylpyrimidin-1-ium-2-yl]sulfanylhexanoate (PubChem CID 177163770) has the molecular formula C32H33N4O4S2+ and a molecular weight of 601.77 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[6-methyl-4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylpyrimidin-1-ium-2-yl]sulfanylhexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[6-methyl-4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylpyrimidin-1-ium-2-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 177163770 |
| Molecular Formula | C32H33N4O4S2+ |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[6-methyl-4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylpyrimidin-1-ium-2-yl]sulfanylhexanoate |
| SMILES | Cc1cc(/C=C/C=C2/Sc3ccccc3N2C)nc(SCCCCCC(=O)ON2C(=O)CCC2=O)[n+]1-c1ccccc1 |
| InChI | InChI=1S/C32H33N4O4S2/c1-23-22-24(12-11-17-30-34(2)26-15-8-9-16-27(26)42-30)33-32(35(23)25-13-5-3-6-14-25)41-21-10-4-7-18-31(39)40-36-28(37)19-20-29(36)38/h3,5-6,8-9,11-17,22H,4,7,10,18-21H2,1-2H3/q+1 |
| InChIKey | HFKKMKRTQTUBJU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 83.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|