C29H44N8O2Si — CID 177165643
2-[3-[[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]methyl]anilino]-N-cyclobutyl-6-(methylamino)purine-9-carboxamide (PubChem CID 177165643) has the molecular formula C29H44N8O2Si and a molecular weight of 564.81 g/mol. Its IUPAC name is 2-[3-[[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]methyl]anilino]-N-cyclobutyl-6-(methylamino)purine-9-carboxamide.
| Compound Name | 2-[3-[[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]methyl]anilino]-N-cyclobutyl-6-(methylamino)purine-9-carboxamide |
|---|---|
| PubChem CID | 177165643 |
| Molecular Formula | C29H44N8O2Si |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | 2-[3-[[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]methyl]anilino]-N-cyclobutyl-6-(methylamino)purine-9-carboxamide |
| SMILES | CNc1nc(Nc2cccc(CN3CCCC(O[Si](C)(C)C(C)(C)C)C3)c2)nc2c1ncn2C(=O)NC1CCC1 |
| InChI | InChI=1S/C29H44N8O2Si/c1-29(2,3)40(5,6)39-23-14-9-15-36(18-23)17-20-10-7-13-22(16-20)32-27-34-25(30-4)24-26(35-27)37(19-31-24)28(38)33-21-11-8-12-21/h7,10,13,16,19,21,23H,8-9,11-12,14-15,17-18H2,1-6H3,(H,33,38)(H2,30,32,34,35) |
| InChIKey | GADNZTQANYSKOT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|