C11H26N2O3 — CID 177167063
N-[2-(ethylamino)-2-oxoethoxy]-4-methylhexanamide;molecular hydrogen (PubChem CID 177167063) has the molecular formula C11H26N2O3 and a molecular weight of 234.34 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxoethoxy]-4-methylhexanamide;molecular hydrogen.
| Compound Name | N-[2-(ethylamino)-2-oxoethoxy]-4-methylhexanamide;molecular hydrogen |
|---|---|
| PubChem CID | 177167063 |
| Molecular Formula | C11H26N2O3 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | N-[2-(ethylamino)-2-oxoethoxy]-4-methylhexanamide;molecular hydrogen |
| SMILES | CCNC(=O)CONC(=O)CCC(C)CC.[H][H].[H][H] |
| InChI | InChI=1S/C11H22N2O3.2H2/c1-4-9(3)6-7-10(14)13-16-8-11(15)12-5-2;;/h9H,4-8H2,1-3H3,(H,12,15)(H,13,14);2*1H |
| InChIKey | BRIGLRSXGRIKRA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|