C12H7F6N3O2 — CID 177167962
1-[[4,5-bis(trifluoromethyl)-2-pyridinyl]amino]-3-methylpyrrole-2,5-dione (PubChem CID 177167962) has the molecular formula C12H7F6N3O2 and a molecular weight of 339.20 g/mol. Its IUPAC name is 1-[[4,5-bis(trifluoromethyl)-2-pyridinyl]amino]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[[4,5-bis(trifluoromethyl)-2-pyridinyl]amino]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 177167962 |
| Molecular Formula | C12H7F6N3O2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-[[4,5-bis(trifluoromethyl)-2-pyridinyl]amino]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(Nc2cc(C(F)(F)F)c(C(F)(F)F)cn2)C1=O |
| InChI | InChI=1S/C12H7F6N3O2/c1-5-2-9(22)21(10(5)23)20-8-3-6(11(13,14)15)7(4-19-8)12(16,17)18/h2-4H,1H3,(H,19,20) |
| InChIKey | TUJLXMUHMZFZHR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|