C13H18BrN3O — CID 177187348
2-bromo-6-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyridine;ethane (PubChem CID 177187348) has the molecular formula C13H18BrN3O and a molecular weight of 312.21 g/mol. Its IUPAC name is 2-bromo-6-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyridine;ethane.
| Compound Name | 2-bromo-6-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyridine;ethane |
|---|---|
| PubChem CID | 177187348 |
| Molecular Formula | C13H18BrN3O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-bromo-6-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyridine;ethane |
| SMILES | Brc1nc2ccc(C3CCOCC3)cn2n1.CC |
| InChI | InChI=1S/C11H12BrN3O.C2H6/c12-11-13-10-2-1-9(7-15(10)14-11)8-3-5-16-6-4-8;1-2/h1-2,7-8H,3-6H2;1-2H3 |
| InChIKey | MWQQNBDGQJZUHU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |