C8H11F2NO2 — CID 177205169
6-(difluoromethoxy)-1H-pyridin-2-one;ethane (PubChem CID 177205169) has the molecular formula C8H11F2NO2 and a molecular weight of 191.18 g/mol. Its IUPAC name is 6-(difluoromethoxy)-1H-pyridin-2-one;ethane.
| Compound Name | 6-(difluoromethoxy)-1H-pyridin-2-one;ethane |
|---|---|
| PubChem CID | 177205169 |
| Molecular Formula | C8H11F2NO2 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 6-(difluoromethoxy)-1H-pyridin-2-one;ethane |
| SMILES | CC.O=c1cccc(OC(F)F)[nH]1 |
| InChI | InChI=1S/C6H5F2NO2.C2H6/c7-6(8)11-5-3-1-2-4(10)9-5;1-2/h1-3,6H,(H,9,10);1-2H3 |
| InChIKey | FNSNRDDFBPDHLT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |