C12H16O3 — CID 177209416
(E)-3-[4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]prop-2-en-1-ol (PubChem CID 177209416) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (E)-3-[4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 177209416 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (E)-3-[4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]prop-2-en-1-ol |
| SMILES | OC/C=C/C1C=CC(OCC2CO2)=CC1 |
| InChI | InChI=1S/C12H16O3/c13-7-1-2-10-3-5-11(6-4-10)14-8-12-9-15-12/h1-3,5-6,10,12-13H,4,7-9H2/b2-1+ |
| InChIKey | IPBLDDNUWNRNEP-OWOJBTEDSA-N |
| XLogP | 1.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|