C29H35ClNO3+ — CID 177225283
spiro[5-azoniatricyclo[4.2.0.01,4]octane-5,1'-azolidin-1-ium]-2-yl 2-(1-chlorobutoxy)-2,2-diphenylacetate (PubChem CID 177225283) has the molecular formula C29H35ClNO3+ and a molecular weight of 481.06 g/mol. Its IUPAC name is spiro[5-azoniatricyclo[4.2.0.01,4]octane-5,1'-azolidin-1-ium]-2-yl 2-(1-chlorobutoxy)-2,2-diphenylacetate.
| Compound Name | spiro[5-azoniatricyclo[4.2.0.01,4]octane-5,1'-azolidin-1-ium]-2-yl 2-(1-chlorobutoxy)-2,2-diphenylacetate |
|---|---|
| PubChem CID | 177225283 |
| Molecular Formula | C29H35ClNO3+ |
| Molecular Weight | 481.06 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | spiro[5-azoniatricyclo[4.2.0.01,4]octane-5,1'-azolidin-1-ium]-2-yl 2-(1-chlorobutoxy)-2,2-diphenylacetate |
| SMILES | CCCC(Cl)OC(C(=O)OC1CC2C13CCC3[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35ClNO3/c1-2-11-26(30)34-29(21-12-5-3-6-13-21,22-14-7-4-8-15-22)27(32)33-25-20-24-28(25)17-16-23(28)31(24)18-9-10-19-31/h3-8,12-15,23-26H,2,9-11,16-20H2,1H3/q+1 |
| InChIKey | IXNBQYSRWLMEOD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.06 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|