C28H31N3O9 — CID 177229639
1,10,11,12a-tetrahydroxy-4-(oxan-4-ylamino)-3,12-dioxo-7-(2-oxopyrrolidin-1-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229639) has the molecular formula C28H31N3O9 and a molecular weight of 553.57 g/mol. Its IUPAC name is 1,10,11,12a-tetrahydroxy-4-(oxan-4-ylamino)-3,12-dioxo-7-(2-oxopyrrolidin-1-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,10,11,12a-tetrahydroxy-4-(oxan-4-ylamino)-3,12-dioxo-7-(2-oxopyrrolidin-1-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229639 |
| Molecular Formula | C28H31N3O9 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 1,10,11,12a-tetrahydroxy-4-(oxan-4-ylamino)-3,12-dioxo-7-(2-oxopyrrolidin-1-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(N5CCCC5=O)c4CC3CC2C(NC2CCOCC2)C1=O |
| InChI | InChI=1S/C28H31N3O9/c29-27(38)21-24(35)22(30-13-5-8-40-9-6-13)15-11-12-10-14-16(31-7-1-2-18(31)33)3-4-17(32)20(14)23(34)19(12)25(36)28(15,39)26(21)37/h3-4,12-13,15,22,30,32,34,37,39H,1-2,5-11H2,(H2,29,38) |
| InChIKey | WAYIGQMFYGVKQF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|