About cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide
cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide (PubChem CID 177240292) has the molecular formula C14H14CdF4N3O3-
and a molecular weight of 460.69 g/mol. Its IUPAC name is cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide.
Molecular Properties
| Compound Name | cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide |
| PubChem CID | 177240292 |
| Molecular Formula | C14H14CdF4N3O3- |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide |
| SMILES | O=C([N-]CC1(F)CCN(c2ccc([N+](=O)[O-])cc2)CC1)C(F)(F)F.[Cd] |
| InChI | InChI=1S/C14H15F4N3O3.Cd/c15-13(9-19-12(22)14(16,17)18)5-7-20(8-6-13)10-1-3-11(4-2-10)21(23)24;/h1-4H,5-9H2,(H,19,22);/p-1 |
| InChIKey | FZYPINRAZOTYLG-UHFFFAOYSA-M |
| XLogP | 3.36 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide?
The IUPAC name of cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide (CID 177240292) is cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide.
What is the SMILES notation for cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide?
The canonical SMILES for cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide is O=C([N-]CC1(F)CCN(c2ccc([N+](=O)[O-])cc2)CC1)C(F)(F)F.[Cd].
What is the InChIKey of cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide?
The InChIKey is FZYPINRAZOTYLG-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H15F4N3O3.Cd/c15-13(9-19-12(22)14(16,17)18)5-7-20(8-6-13)10-1-3-11(4-2-10)21(23)24;/h1-4H,5-9H2,(H,19,22);/p-1.
What are the key properties of cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide?
cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide has a molecular weight of 460.69 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;[4-fluoro-1-(4-nitrophenyl)piperidin-4-yl]methyl-(2,2,2-trifluoroacetyl)azanide is sourced from PubChem (CID 177240292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).