C54H51N3 — CID 177276947
3,6-ditert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-6-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenylcyclohexa-1,3-dien-1-yl]carbazole (PubChem CID 177276947) has the molecular formula C54H51N3 and a molecular weight of 742.02 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-6-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenylcyclohexa-1,3-dien-1-yl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-6-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenylcyclohexa-1,3-dien-1-yl]carbazole |
|---|---|
| PubChem CID | 177276947 |
| Molecular Formula | C54H51N3 |
| Molecular Weight | 742.02 g/mol |
| Exact Mass | 741.41 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-6-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenylcyclohexa-1,3-dien-1-yl]carbazole |
| SMILES | C=C/C=C(\C=C)C1CC(c2nc(-c3ccccc3)cc(-c3ccccc3)n2)=CC(c2ccccc2)=C1n1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C54H51N3/c1-9-20-36(10-2)43-31-40(52-55-47(38-23-16-12-17-24-38)35-48(56-52)39-25-18-13-19-26-39)32-44(37-21-14-11-15-22-37)51(43)57-49-29-27-41(53(3,4)5)33-45(49)46-34-42(54(6,7)8)28-30-50(46)57/h9-30,32-35,43H,1-2,31H2,3-8H3/b36-20+ |
| InChIKey | KPGVTXFWIVNQOK-ZSNJKBEMSA-N |
| XLogP | 14.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.02 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|