C13H12N2O5 — CID 177278517
N-(7-hydroxyimino-6-oxo-8,9-dihydrobenzo[g][1,3]benzodioxol-5-yl)acetamide (PubChem CID 177278517) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is N-(7-hydroxyimino-6-oxo-8,9-dihydrobenzo[g][1,3]benzodioxol-5-yl)acetamide.
| Compound Name | N-(7-hydroxyimino-6-oxo-8,9-dihydrobenzo[g][1,3]benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 177278517 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(7-hydroxyimino-6-oxo-8,9-dihydrobenzo[g][1,3]benzodioxol-5-yl)acetamide |
| SMILES | CC(=O)Nc1cc2c(c3c1C(=O)C(=NO)CC3)OCO2 |
| InChI | InChI=1S/C13H12N2O5/c1-6(16)14-9-4-10-13(20-5-19-10)7-2-3-8(15-18)12(17)11(7)9/h4,18H,2-3,5H2,1H3,(H,14,16) |
| InChIKey | LZRXJNZPXNQKRM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|