C24H33N3O3 — CID 177314051
4-[3-[(E)-N-(methoxymethyl)-C-(2-methoxyquinolin-6-yl)carbonimidoyl]piperidin-1-yl]cyclohexan-1-ol (PubChem CID 177314051) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[3-[(E)-N-(methoxymethyl)-C-(2-methoxyquinolin-6-yl)carbonimidoyl]piperidin-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[3-[(E)-N-(methoxymethyl)-C-(2-methoxyquinolin-6-yl)carbonimidoyl]piperidin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 177314051 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 4-[3-[(E)-N-(methoxymethyl)-C-(2-methoxyquinolin-6-yl)carbonimidoyl]piperidin-1-yl]cyclohexan-1-ol |
| SMILES | COC/N=C(/c1ccc2nc(OC)ccc2c1)C1CCCN(C2CCC(O)CC2)C1 |
| InChI | InChI=1S/C24H33N3O3/c1-29-16-25-24(18-5-11-22-17(14-18)6-12-23(26-22)30-2)19-4-3-13-27(15-19)20-7-9-21(28)10-8-20/h5-6,11-12,14,19-21,28H,3-4,7-10,13,15-16H2,1-2H3/b25-24- |
| InChIKey | UJFUFAYNFQKUIC-IZHYLOQSSA-N |
| XLogP | 3.65 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|