About 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide
2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide (PubChem CID 177333142) has the molecular formula C13H15N3O3S
and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide |
| PubChem CID | 177333142 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide |
| SMILES | NC(=O)C(Oc1nc2ccc(N)cc2s1)C1CCOC1 |
| InChI | InChI=1S/C13H15N3O3S/c14-8-1-2-9-10(5-8)20-13(16-9)19-11(12(15)17)7-3-4-18-6-7/h1-2,5,7,11H,3-4,6,14H2,(H2,15,17) |
| InChIKey | MVSAYBZCZLWCHV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide?
The IUPAC name of 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide (CID 177333142) is 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide.
What is the SMILES notation for 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide?
The canonical SMILES for 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide is NC(=O)C(Oc1nc2ccc(N)cc2s1)C1CCOC1.
What is the InChIKey of 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide?
The InChIKey is MVSAYBZCZLWCHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3S/c14-8-1-2-9-10(5-8)20-13(16-9)19-11(12(15)17)7-3-4-18-6-7/h1-2,5,7,11H,3-4,6,14H2,(H2,15,17).
What are the key properties of 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide?
2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide has a molecular weight of 293.35 g/mol, XLogP of 1.15, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-amino-1,3-benzothiazol-2-yl)oxy]-2-(oxolan-3-yl)acetamide is sourced from PubChem (CID 177333142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).