C23H32ClN3 — CID 177346395
N-[3-[(3E)-5-chloro-4-methylhexa-1,3,5-trien-3-yl]azetidin-3-yl]quinolin-7-amine;ethane (PubChem CID 177346395) has the molecular formula C23H32ClN3 and a molecular weight of 385.98 g/mol. Its IUPAC name is N-[3-[(3E)-5-chloro-4-methylhexa-1,3,5-trien-3-yl]azetidin-3-yl]quinolin-7-amine;ethane.
| Compound Name | N-[3-[(3E)-5-chloro-4-methylhexa-1,3,5-trien-3-yl]azetidin-3-yl]quinolin-7-amine;ethane |
|---|---|
| PubChem CID | 177346395 |
| Molecular Formula | C23H32ClN3 |
| Molecular Weight | 385.98 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[3-[(3E)-5-chloro-4-methylhexa-1,3,5-trien-3-yl]azetidin-3-yl]quinolin-7-amine;ethane |
| SMILES | C=C/C(=C(/C)C(=C)Cl)C1(Nc2ccc3cccnc3c2)CNC1.CC.CC |
| InChI | InChI=1S/C19H20ClN3.2C2H6/c1-4-17(13(2)14(3)20)19(11-21-12-19)23-16-8-7-15-6-5-9-22-18(15)10-16;2*1-2/h4-10,21,23H,1,3,11-12H2,2H3;2*1-2H3/b17-13+;; |
| InChIKey | CTNBNGMOPOSILV-ZEIDDFDZSA-N |
| XLogP | 6.30 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.98 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|