C20H25N5O4 — CID 177347301
tert-butyl 3-(5-methyl-4-methylidene-6-nitro-8,9-dihydropyrazolo[5,4-c]quinolin-3-yl)azetidine-1-carboxylate (PubChem CID 177347301) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is tert-butyl 3-(5-methyl-4-methylidene-6-nitro-8,9-dihydropyrazolo[5,4-c]quinolin-3-yl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-methyl-4-methylidene-6-nitro-8,9-dihydropyrazolo[5,4-c]quinolin-3-yl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 177347301 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | tert-butyl 3-(5-methyl-4-methylidene-6-nitro-8,9-dihydropyrazolo[5,4-c]quinolin-3-yl)azetidine-1-carboxylate |
| SMILES | C=C1c2c(cnn2C2CN(C(=O)OC(C)(C)C)C2)C2=C(C([N+](=O)[O-])=CCC2)N1C |
| InChI | InChI=1S/C20H25N5O4/c1-12-17-15(14-7-6-8-16(25(27)28)18(14)22(12)5)9-21-24(17)13-10-23(11-13)19(26)29-20(2,3)4/h8-9,13H,1,6-7,10-11H2,2-5H3 |
| InChIKey | OBPVMSNSTNJZCE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|