C48H78N2O6 — CID 177352969
heptadecan-9-yl 6-[3-(dimethylamino)propyl-[5-[2-(4-phenoxyphenyl)propanoyloxy]pentanoyl]amino]hexanoate (PubChem CID 177352969) has the molecular formula C48H78N2O6 and a molecular weight of 779.16 g/mol. Its IUPAC name is heptadecan-9-yl 6-[3-(dimethylamino)propyl-[5-[2-(4-phenoxyphenyl)propanoyloxy]pentanoyl]amino]hexanoate.
| Compound Name | heptadecan-9-yl 6-[3-(dimethylamino)propyl-[5-[2-(4-phenoxyphenyl)propanoyloxy]pentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 177352969 |
| Molecular Formula | C48H78N2O6 |
| Molecular Weight | 779.16 g/mol |
| Exact Mass | 778.59 |
| IUPAC Name | heptadecan-9-yl 6-[3-(dimethylamino)propyl-[5-[2-(4-phenoxyphenyl)propanoyloxy]pentanoyl]amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCN(CCCN(C)C)C(=O)CCCCOC(=O)C(C)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C48H78N2O6/c1-6-8-10-12-14-18-29-44(30-19-15-13-11-9-7-2)56-47(52)32-22-17-24-38-50(39-26-37-49(4)5)46(51)31-23-25-40-54-48(53)41(3)42-33-35-45(36-34-42)55-43-27-20-16-21-28-43/h16,20-21,27-28,33-36,41,44H,6-15,17-19,22-26,29-32,37-40H2,1-5H3 |
| InChIKey | BZJYQPXPPXTWDD-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.16 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|