C19H30N2 — CID 177354537
(2E,4E,6Z,8E)-5-ethyl-9,10-dimethyl-7-methylidene-6-(2-methyliminoethylidene)undeca-2,4,8-trien-2-amine (PubChem CID 177354537) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-5-ethyl-9,10-dimethyl-7-methylidene-6-(2-methyliminoethylidene)undeca-2,4,8-trien-2-amine.
| Compound Name | (2E,4E,6Z,8E)-5-ethyl-9,10-dimethyl-7-methylidene-6-(2-methyliminoethylidene)undeca-2,4,8-trien-2-amine |
|---|---|
| PubChem CID | 177354537 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | (2E,4E,6Z,8E)-5-ethyl-9,10-dimethyl-7-methylidene-6-(2-methyliminoethylidene)undeca-2,4,8-trien-2-amine |
| SMILES | C=C(/C=C(\C)C(C)C)C(=C\C=N\C)/C(=C/C=C(\C)N)CC |
| InChI | InChI=1S/C19H30N2/c1-8-18(10-9-17(6)20)19(11-12-21-7)16(5)13-15(4)14(2)3/h9-14H,5,8,20H2,1-4,6-7H3/b15-13+,17-9+,18-10+,19-11+,21-12+ |
| InChIKey | QOQKZIFTWIMFNH-ZUGOHBCGSA-N |
| XLogP | 4.97 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|