C20H16F5NO2 — CID 177386335
(4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-yl)methyl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 177386335) has the molecular formula C20H16F5NO2 and a molecular weight of 397.34 g/mol. Its IUPAC name is (4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-yl)methyl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | (4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-yl)methyl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 177386335 |
| Molecular Formula | C20H16F5NO2 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-yl)methyl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | CC1(C)CC(COC(=O)c2c(F)c(F)c(F)c(F)c2F)N=C1c1ccccc1 |
| InChI | InChI=1S/C20H16F5NO2/c1-20(2)8-11(26-18(20)10-6-4-3-5-7-10)9-28-19(27)12-13(21)15(23)17(25)16(24)14(12)22/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | MJZYSMYNUOQRKM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|