About 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate
2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate (PubChem CID 59157302) has the molecular formula C21H19F2NO4
and a molecular weight of 387.38 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate.
Molecular Properties
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate |
| PubChem CID | 59157302 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1cccc(/C(=N\C)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C21H19F2NO4/c1-13(2)20(25)27-10-11-28-21(26)15-7-4-6-14(12-15)19(24-3)18-16(22)8-5-9-17(18)23/h4-9,12H,1,10-11H2,2-3H3/b24-19+ |
| InChIKey | BFHBQIMFJDCCIC-LYBHJNIJSA-N |
| XLogP | 3.71 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate?
The IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate (CID 59157302) is 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate.
What is the SMILES notation for 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate?
The canonical SMILES for 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate is C=C(C)C(=O)OCCOC(=O)c1cccc(/C(=N\C)c2c(F)cccc2F)c1.
What is the InChIKey of 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate?
The InChIKey is BFHBQIMFJDCCIC-LYBHJNIJSA-N. The full InChI is InChI=1S/C21H19F2NO4/c1-13(2)20(25)27-10-11-28-21(26)15-7-4-6-14(12-15)19(24-3)18-16(22)8-5-9-17(18)23/h4-9,12H,1,10-11H2,2-3H3/b24-19+.
What are the key properties of 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate?
2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate has a molecular weight of 387.38 g/mol, XLogP of 3.71, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-2-enoyloxy)ethyl 3-[C-(2,6-difluorophenyl)-N-methylcarbonimidoyl]benzoate is sourced from PubChem (CID 59157302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).