C19H23NO4 — CID 177389685
dimethyl (4aS,7aR)-2-benzyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyridine-3,4-dicarboxylate (PubChem CID 177389685) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is dimethyl (4aS,7aR)-2-benzyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyridine-3,4-dicarboxylate.
| Compound Name | dimethyl (4aS,7aR)-2-benzyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 177389685 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | dimethyl (4aS,7aR)-2-benzyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyridine-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(Cc2ccccc2)C[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C19H23NO4/c1-23-18(21)16-15-10-6-9-14(15)12-20(17(16)19(22)24-2)11-13-7-4-3-5-8-13/h3-5,7-8,14-15H,6,9-12H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | JKWKRYAONHWAHU-GJZGRUSLSA-N |
| XLogP | 2.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |