About zinc;ethynyl(trimethyl)silane;phenylbenzene
zinc;ethynyl(trimethyl)silane;phenylbenzene (PubChem CID 177389765) has the molecular formula C17H18SiZn
and a molecular weight of 315.81 g/mol. Its IUPAC name is zinc;ethynyl(trimethyl)silane;phenylbenzene.
Molecular Properties
| Compound Name | zinc;ethynyl(trimethyl)silane;phenylbenzene |
| PubChem CID | 177389765 |
| Molecular Formula | C17H18SiZn |
| Molecular Weight | 315.81 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | zinc;ethynyl(trimethyl)silane;phenylbenzene |
| SMILES | [C-]#C[Si](C)(C)C.[Zn+2].[c-]1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H9.C5H9Si.Zn/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5-6(2,3)4;/h1-9H;2-4H3;/q2*-1;+2 |
| InChIKey | JFGFCZJSIOZXJM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze zinc;ethynyl(trimethyl)silane;phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;ethynyl(trimethyl)silane;phenylbenzene?
The IUPAC name of zinc;ethynyl(trimethyl)silane;phenylbenzene (CID 177389765) is zinc;ethynyl(trimethyl)silane;phenylbenzene.
What is the SMILES notation for zinc;ethynyl(trimethyl)silane;phenylbenzene?
The canonical SMILES for zinc;ethynyl(trimethyl)silane;phenylbenzene is [C-]#C[Si](C)(C)C.[Zn+2].[c-]1ccccc1-c1ccccc1.
What is the InChIKey of zinc;ethynyl(trimethyl)silane;phenylbenzene?
The InChIKey is JFGFCZJSIOZXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9.C5H9Si.Zn/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5-6(2,3)4;/h1-9H;2-4H3;/q2*-1;+2.
What are the key properties of zinc;ethynyl(trimethyl)silane;phenylbenzene?
zinc;ethynyl(trimethyl)silane;phenylbenzene has a molecular weight of 315.81 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;ethynyl(trimethyl)silane;phenylbenzene is sourced from PubChem (CID 177389765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).