C32H53BO4Si — CID 177390061
2-trimethylsilylethyl (2Z,3E,5E,7E,9E,11E)-2-[(2S,4S)-2,4-dimethylhexylidene]-4-methyl-12-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dodeca-3,5,7,9,11-pentaenoate (PubChem CID 177390061) has the molecular formula C32H53BO4Si and a molecular weight of 540.67 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2Z,3E,5E,7E,9E,11E)-2-[(2S,4S)-2,4-dimethylhexylidene]-4-methyl-12-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dodeca-3,5,7,9,11-pentaenoate.
| Compound Name | 2-trimethylsilylethyl (2Z,3E,5E,7E,9E,11E)-2-[(2S,4S)-2,4-dimethylhexylidene]-4-methyl-12-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dodeca-3,5,7,9,11-pentaenoate |
|---|---|
| PubChem CID | 177390061 |
| Molecular Formula | C32H53BO4Si |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | 2-trimethylsilylethyl (2Z,3E,5E,7E,9E,11E)-2-[(2S,4S)-2,4-dimethylhexylidene]-4-methyl-12-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dodeca-3,5,7,9,11-pentaenoate |
| SMILES | CC[C@H](C)C[C@H](C)/C=C(/C=C(C)/C=C/C=C/C=C/C=C/B1OC(C)(C)C(C)(C)O1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C32H53BO4Si/c1-12-26(2)23-28(4)25-29(30(34)35-21-22-38(9,10)11)24-27(3)19-17-15-13-14-16-18-20-33-36-31(5,6)32(7,8)37-33/h13-20,24-26,28H,12,21-23H2,1-11H3/b15-13+,16-14+,19-17+,20-18+,27-24+,29-25-/t26-,28-/m0/s1 |
| InChIKey | UEGJPAMVPKTORK-PHRMUERYSA-N |
| XLogP | 8.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|