C66H90Bi2 — CID 177390862
[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]-[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]bismuthanylidenebismuthane (PubChem CID 177390862) has the molecular formula C66H90Bi2 and a molecular weight of 1301.41 g/mol. Its IUPAC name is [2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]-[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]bismuthanylidenebismuthane.
| Compound Name | [2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]-[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]bismuthanylidenebismuthane |
|---|---|
| PubChem CID | 177390862 |
| Molecular Formula | C66H90Bi2 |
| Molecular Weight | 1301.41 g/mol |
| Exact Mass | 1300.67 |
| IUPAC Name | [2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]-[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]bismuthanylidenebismuthane |
| SMILES | CC(C)(C)c1cc(C2=CC=C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)C2/[Bi]=[Bi]/C2C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=CC=C2c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/2C33H45.2Bi/c2*1-30(2,3)26-16-24(17-27(20-26)31(4,5)6)22-13-14-23(15-22)25-18-28(32(7,8)9)21-29(19-25)33(10,11)12;;/h2*13-21H,1-12H3;; |
| InChIKey | DZTVRDWYJUBJBO-UHFFFAOYSA-N |
| XLogP | 18.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1301.41 |
| LogP ≤ 5 | 18.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |