C33H45 — CID 102196691
CID 102196691 (PubChem CID 102196691) has the molecular formula C33H45 and a molecular weight of 441.72 g/mol.
| Compound Name | CID 102196691 |
|---|---|
| PubChem CID | 102196691 |
| Molecular Formula | C33H45 |
| Molecular Weight | 441.72 g/mol |
| Exact Mass | 441.35 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc([C]2C=CC(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H45/c1-30(2,3)26-16-24(17-27(20-26)31(4,5)6)22-13-14-23(15-22)25-18-28(32(7,8)9)21-29(19-25)33(10,11)12/h13-21H,1-12H3 |
| InChIKey | NNJPCUOOMHDXPL-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.72 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |