C33H47Sb — CID 177442086
[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]stibane (PubChem CID 177442086) has the molecular formula C33H47Sb and a molecular weight of 565.50 g/mol. Its IUPAC name is [2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]stibane.
| Compound Name | [2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]stibane |
|---|---|
| PubChem CID | 177442086 |
| Molecular Formula | C33H47Sb |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]stibane |
| SMILES | CC(C)(C)c1cc(C2=CC=C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)C2[SbH2])cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H45.Sb.2H/c1-30(2,3)26-16-24(17-27(20-26)31(4,5)6)22-13-14-23(15-22)25-18-28(32(7,8)9)21-29(19-25)33(10,11)12;;;/h13-21H,1-12H3;;; |
| InChIKey | UWTWGPDBISVKDZ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|