C13H17F3Si2 — CID 177399208
CID 177399208 (PubChem CID 177399208) has the molecular formula C13H17F3Si2 and a molecular weight of 286.45 g/mol.
| Compound Name | CID 177399208 |
|---|---|
| PubChem CID | 177399208 |
| Molecular Formula | C13H17F3Si2 |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)C[Si]/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3Si2/c1-18(2,3)10-17-9-8-11-4-6-12(7-5-11)13(14,15)16/h4-9H,10H2,1-3H3/b9-8+ |
| InChIKey | UAJIOYJMJLJOEX-CMDGGOBGSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|