C25H33O4Se+ — CID 177404406
(1,3-diethoxy-1-hydroxy-3-oxoprop-1-en-2-yl)-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selanium (PubChem CID 177404406) has the molecular formula C25H33O4Se+ and a molecular weight of 476.50 g/mol. Its IUPAC name is (1,3-diethoxy-1-hydroxy-3-oxoprop-1-en-2-yl)-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selanium.
| Compound Name | (1,3-diethoxy-1-hydroxy-3-oxoprop-1-en-2-yl)-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selanium |
|---|---|
| PubChem CID | 177404406 |
| Molecular Formula | C25H33O4Se+ |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (1,3-diethoxy-1-hydroxy-3-oxoprop-1-en-2-yl)-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selanium |
| SMILES | CCOC(=O)C(/[Se+]=C1/C2(Cc3ccccc3C2)C2CCC1(C)C2(C)C)=C(O)OCC |
| InChI | InChI=1S/C25H32O4Se/c1-6-28-20(26)19(21(27)29-7-2)30-22-24(5)13-12-18(23(24,3)4)25(22)14-16-10-8-9-11-17(16)15-25/h8-11,18H,6-7,12-15H2,1-5H3/p+1 |
| InChIKey | OUNJEXSMLFUVAG-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|