C19H29NO5 — CID 177406108
N-[(E)-3-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]but-2-enoxy]-1-phenylmethanamine (PubChem CID 177406108) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is N-[(E)-3-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]but-2-enoxy]-1-phenylmethanamine.
| Compound Name | N-[(E)-3-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]but-2-enoxy]-1-phenylmethanamine |
|---|---|
| PubChem CID | 177406108 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-[(E)-3-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]but-2-enoxy]-1-phenylmethanamine |
| SMILES | COC[C@@H]1OC(C)(/C(C)=C/CONCc2ccccc2)O[C@H]1COC |
| InChI | InChI=1S/C19H29NO5/c1-15(10-11-23-20-12-16-8-6-5-7-9-16)19(2)24-17(13-21-3)18(25-19)14-22-4/h5-10,17-18,20H,11-14H2,1-4H3/b15-10+/t17-,18-/m0/s1 |
| InChIKey | OHBXLIDGZWZTCC-WOVXLNPSSA-N |
| XLogP | 2.45 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|