C15H21NO4 — CID 101130697
1-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]-N-phenylmethanimine (PubChem CID 101130697) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]-N-phenylmethanimine.
| Compound Name | 1-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]-N-phenylmethanimine |
|---|---|
| PubChem CID | 101130697 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-[(4S,5S)-4,5-bis(methoxymethyl)-2-methyl-1,3-dioxolan-2-yl]-N-phenylmethanimine |
| SMILES | COC[C@@H]1OC(C)(/C=N/c2ccccc2)O[C@H]1COC |
| InChI | InChI=1S/C15H21NO4/c1-15(11-16-12-7-5-4-6-8-12)19-13(9-17-2)14(20-15)10-18-3/h4-8,11,13-14H,9-10H2,1-3H3/b16-11+/t13-,14-/m0/s1 |
| InChIKey | FETZASVWLJFLHY-XFPDNBNNSA-N |
| XLogP | 2.18 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|