C16H27NO4Sn — CID 177407801
methyl 2-[(6S,7S,7aS)-3-oxo-6-[(E)-4-trimethylstannylbut-2-en-2-yl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]acetate (PubChem CID 177407801) has the molecular formula C16H27NO4Sn and a molecular weight of 416.11 g/mol. Its IUPAC name is methyl 2-[(6S,7S,7aS)-3-oxo-6-[(E)-4-trimethylstannylbut-2-en-2-yl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]acetate.
| Compound Name | methyl 2-[(6S,7S,7aS)-3-oxo-6-[(E)-4-trimethylstannylbut-2-en-2-yl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]acetate |
|---|---|
| PubChem CID | 177407801 |
| Molecular Formula | C16H27NO4Sn |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | methyl 2-[(6S,7S,7aS)-3-oxo-6-[(E)-4-trimethylstannylbut-2-en-2-yl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]acetate |
| SMILES | COC(=O)C[C@H]1[C@@H](/C(C)=C/C[Sn](C)(C)C)CN2C(=O)OC[C@H]12 |
| InChI | InChI=1S/C13H18NO4.3CH3.Sn/c1-4-8(2)10-6-14-11(7-18-13(14)16)9(10)5-12(15)17-3;;;;/h4,9-11H,1,5-7H2,2-3H3;3*1H3;/b8-4+;;;;/t9-,10+,11+;;;;/m0..../s1 |
| InChIKey | PZKFMRMBEDUGNP-MGSFCKGNSA-N |
| XLogP | 2.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|