C16H21NO4S — CID 177413041
(2E)-2-[4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]propanoic acid (PubChem CID 177413041) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (2E)-2-[4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]propanoic acid.
| Compound Name | (2E)-2-[4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]propanoic acid |
|---|---|
| PubChem CID | 177413041 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2E)-2-[4,5-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]propanoic acid |
| SMILES | C/C(C(=O)O)=C1\CN(S(=O)(=O)c2ccc(C)cc2)C(C)C1C |
| InChI | InChI=1S/C16H21NO4S/c1-10-5-7-14(8-6-10)22(20,21)17-9-15(11(2)13(17)4)12(3)16(18)19/h5-8,11,13H,9H2,1-4H3,(H,18,19)/b15-12- |
| InChIKey | OQBPZLJBJHUFTK-QINSGFPZSA-N |
| XLogP | 2.43 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|