C29H46N2O2SSi — CID 177419848
(2Z)-2-[2,3-dimethyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]-2-tri(propan-2-yl)silylacetonitrile (PubChem CID 177419848) has the molecular formula C29H46N2O2SSi and a molecular weight of 514.85 g/mol. Its IUPAC name is (2Z)-2-[2,3-dimethyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]-2-tri(propan-2-yl)silylacetonitrile.
| Compound Name | (2Z)-2-[2,3-dimethyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]-2-tri(propan-2-yl)silylacetonitrile |
|---|---|
| PubChem CID | 177419848 |
| Molecular Formula | C29H46N2O2SSi |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | (2Z)-2-[2,3-dimethyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]-2-tri(propan-2-yl)silylacetonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2C(C)C(C)/C(=C(\C#N)[Si](C(C)C)(C(C)C)C(C)C)C23CCCCC3)cc1 |
| InChI | InChI=1S/C29H46N2O2SSi/c1-20(2)35(21(3)4,22(5)6)27(19-30)28-24(8)25(9)31(29(28)17-11-10-12-18-29)34(32,33)26-15-13-23(7)14-16-26/h13-16,20-22,24-25H,10-12,17-18H2,1-9H3/b28-27- |
| InChIKey | PFPOBHBFDPWGNV-DQSJHHFOSA-N |
| XLogP | 7.76 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|