C19H24N2O2S — CID 71697708
(2E)-2-[3-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]acetonitrile (PubChem CID 71697708) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is (2E)-2-[3-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]acetonitrile.
| Compound Name | (2E)-2-[3-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 71697708 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2E)-2-[3-methyl-1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decan-4-ylidene]acetonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)/C(=C\C#N)C23CCCCC3)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-15-6-8-17(9-7-15)24(22,23)21-14-16(2)18(10-13-20)19(21)11-4-3-5-12-19/h6-10,16H,3-5,11-12,14H2,1-2H3/b18-10+ |
| InChIKey | BABDDFKCYUHOLA-VCHYOVAHSA-N |
| XLogP | 3.79 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|